C21H28O3 — CID 134990337
(1S,2S,4R,10S,11R,14S,15S,18S)-15-acetyl-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one (PubChem CID 134990337) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,2S,4R,10S,11R,14S,15S,18S)-15-acetyl-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one.
| Compound Name | (1S,2S,4R,10S,11R,14S,15S,18S)-15-acetyl-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
|---|---|
| PubChem CID | 134990337 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,2S,4R,10S,11R,14S,15S,18S)-15-acetyl-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-7-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3[C@@H]4O[C@@H]4C4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28O3/c1-11(22)13-4-5-14-17-15(7-9-20(13,14)2)21(3)8-6-12(23)10-16(21)18-19(17)24-18/h10,13-15,17-19H,4-9H2,1-3H3/t13-,14+,15-,17+,18-,19+,20-,21+/m1/s1 |
| InChIKey | NKLRJTMOFLSGSA-MSJSXBLJSA-N |
| XLogP | 3.71 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|