C19H18ClFN2 — CID 134990369
5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydroindole (PubChem CID 134990369) has the molecular formula C19H18ClFN2 and a molecular weight of 328.82 g/mol. Its IUPAC name is 5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydroindole.
| Compound Name | 5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 134990369 |
| Molecular Formula | C19H18ClFN2 |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-chloro-1-(4-fluorophenyl)-3-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydroindole |
| SMILES | Fc1ccc(N2CC(C3=CCNCC3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C19H18ClFN2/c20-14-1-6-19-17(11-14)18(13-7-9-22-10-8-13)12-23(19)16-4-2-15(21)3-5-16/h1-7,11,18,22H,8-10,12H2 |
| InChIKey | HFEODRNYJAGXKW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|