C14H15Cl2NO3S — CID 134990448
6-chloro-2-cyclohexyl-3-oxo-1H-isoindole-5-sulfonyl chloride (PubChem CID 134990448) has the molecular formula C14H15Cl2NO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is 6-chloro-2-cyclohexyl-3-oxo-1H-isoindole-5-sulfonyl chloride.
| Compound Name | 6-chloro-2-cyclohexyl-3-oxo-1H-isoindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 134990448 |
| Molecular Formula | C14H15Cl2NO3S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 6-chloro-2-cyclohexyl-3-oxo-1H-isoindole-5-sulfonyl chloride |
| SMILES | O=C1c2cc(S(=O)(=O)Cl)c(Cl)cc2CN1C1CCCCC1 |
| InChI | InChI=1S/C14H15Cl2NO3S/c15-12-6-9-8-17(10-4-2-1-3-5-10)14(18)11(9)7-13(12)21(16,19)20/h6-7,10H,1-5,8H2 |
| InChIKey | ILXGSOOBMXPZAI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |