C18H32O2 — CID 134990541
2-[(E)-4,4-diethoxy-3-methylbut-2-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 134990541) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 2-[(E)-4,4-diethoxy-3-methylbut-2-enyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-4,4-diethoxy-3-methylbut-2-enyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134990541 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-[(E)-4,4-diethoxy-3-methylbut-2-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(OCC)/C(C)=C/CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H32O2/c1-7-19-17(20-8-2)15(4)11-12-16-14(3)10-9-13-18(16,5)6/h11,17H,7-10,12-13H2,1-6H3/b15-11+ |
| InChIKey | UMJCXLDZSJKDKS-RVDMUPIBSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|