C24H33BrO3 — CID 134990690
(8S,9R,10S,11S,13S,14S,16R,17S)-9-bromo-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 134990690) has the molecular formula C24H33BrO3 and a molecular weight of 449.43 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16R,17S)-9-bromo-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S,16R,17S)-9-bromo-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 134990690 |
| Molecular Formula | C24H33BrO3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16R,17S)-9-bromo-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)[C@@]1(C)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Br)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H33BrO3/c1-6-19(27)23(5)14(2)11-18-17-8-7-15-12-16(26)9-10-21(15,3)24(17,25)20(28)13-22(18,23)4/h9-10,12,14,17-18,20,28H,6-8,11,13H2,1-5H3/t14-,17+,18+,20+,21+,22+,23-,24+/m1/s1 |
| InChIKey | UWOOSJHSZXZSSD-MRCAPQJXSA-N |
| XLogP | 5.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|