C18H16I2N2O4 — CID 134990734
5-[[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 134990734) has the molecular formula C18H16I2N2O4 and a molecular weight of 578.14 g/mol. Its IUPAC name is 5-[[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134990734 |
| Molecular Formula | C18H16I2N2O4 |
| Molecular Weight | 578.14 g/mol |
| Exact Mass | 577.92 |
| IUPAC Name | 5-[[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(Oc2c(I)cc(CC3(C)NC(=O)NC3=O)cc2I)cc1 |
| InChI | InChI=1S/C18H16I2N2O4/c1-18(16(23)21-17(24)22-18)9-10-7-13(19)15(14(20)8-10)26-12-5-3-11(25-2)4-6-12/h3-8H,9H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | CSZFXUBPXAHQON-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.14 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|