About [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate
[3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate (PubChem CID 134990803) has the molecular formula C13H15FINO4S
and a molecular weight of 427.24 g/mol. Its IUPAC name is [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate |
| PubChem CID | 134990803 |
| Molecular Formula | C13H15FINO4S |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(CCI)c1noc2cc(F)ccc12 |
| InChI | InChI=1S/C13H15FINO4S/c1-21(17,18)19-7-5-9(4-6-15)13-11-3-2-10(14)8-12(11)20-16-13/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | ZPULOUGYPVWGBC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate?
The IUPAC name of [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate (CID 134990803) is [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate.
What is the SMILES notation for [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate?
The canonical SMILES for [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate is CS(=O)(=O)OCCC(CCI)c1noc2cc(F)ccc12.
What is the InChIKey of [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate?
The InChIKey is ZPULOUGYPVWGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FINO4S/c1-21(17,18)19-7-5-9(4-6-15)13-11-3-2-10(14)8-12(11)20-16-13/h2-3,8-9H,4-7H2,1H3.
What are the key properties of [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate?
[3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate has a molecular weight of 427.24 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-fluoro-1,2-benzoxazol-3-yl)-5-iodopentyl] methanesulfonate is sourced from PubChem (CID 134990803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).