C21H29NO8 — CID 134990887
2-[[(4aR,7S,8R,8aS)-7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid (PubChem CID 134990887) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[[(4aR,7S,8R,8aS)-7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid.
| Compound Name | 2-[[(4aR,7S,8R,8aS)-7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 134990887 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[[(4aR,7S,8R,8aS)-7-acetamido-2,2-dimethyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
| SMILES | CC(=O)N[C@@H]1C(OCc2ccccc2)O[C@@H]2COC(C)(C)O[C@H]2[C@@H]1OC(C)C(=O)O |
| InChI | InChI=1S/C21H29NO8/c1-12(19(24)25)28-18-16(22-13(2)23)20(26-10-14-8-6-5-7-9-14)29-15-11-27-21(3,4)30-17(15)18/h5-9,12,15-18,20H,10-11H2,1-4H3,(H,22,23)(H,24,25)/t12?,15-,16+,17-,18-,20?/m1/s1 |
| InChIKey | FSTPIAWBNDKLRF-JHRVLHHASA-N |
| XLogP | 1.44 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |