C25H36O6 — CID 134990895
[(1S,2S,4R,6S,7S,10S,11S,14R,16R)-7,11-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-9-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-yl] acetate (PubChem CID 134990895) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(1S,2S,4R,6S,7S,10S,11S,14R,16R)-7,11-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-9-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-yl] acetate.
| Compound Name | [(1S,2S,4R,6S,7S,10S,11S,14R,16R)-7,11-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-9-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-yl] acetate |
|---|---|
| PubChem CID | 134990895 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(1S,2S,4R,6S,7S,10S,11S,14R,16R)-7,11-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)-9-oxo-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2C(=O)C[C@@]2(C)[C@H]3C[C@H]3O[C@]32C2(C)OCCO2)C1 |
| InChI | InChI=1S/C25H36O6/c1-14(26)30-16-7-8-22(2)15(11-16)5-6-17-18-12-20-25(31-20,24(4)28-9-10-29-24)23(18,3)13-19(27)21(17)22/h15-18,20-21H,5-13H2,1-4H3/t15-,16-,17+,18+,20-,21-,22+,23+,25-/m1/s1 |
| InChIKey | JUAOEIMZKNKKLO-ZYYZMRBGSA-N |
| XLogP | 3.65 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|