C24H41NO7Si — CID 134990896
1-O-tert-butyl 3-O-prop-2-enyl 2-[(2R)-2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoyl]propanedioate (PubChem CID 134990896) has the molecular formula C24H41NO7Si and a molecular weight of 483.68 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-prop-2-enyl 2-[(2R)-2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoyl]propanedioate.
| Compound Name | 1-O-tert-butyl 3-O-prop-2-enyl 2-[(2R)-2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoyl]propanedioate |
|---|---|
| PubChem CID | 134990896 |
| Molecular Formula | C24H41NO7Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 1-O-tert-butyl 3-O-prop-2-enyl 2-[(2R)-2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoyl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OC(C)(C)C)C(=O)[C@H](C)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO7Si/c1-12-13-30-21(28)17(22(29)31-23(4,5)6)19(26)14(2)18-16(20(27)25-18)15(3)32-33(10,11)24(7,8)9/h12,14-18H,1,13H2,2-11H3,(H,25,27)/t14-,15-,16-,17?,18-/m1/s1 |
| InChIKey | NSONECXRWKLVIJ-RHUNZGAZSA-N |
| XLogP | 3.40 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|