C18H21NO2 — CID 134990961
(3E,8S,13S,14S)-3-hydroxyimino-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 134990961) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3E,8S,13S,14S)-3-hydroxyimino-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3E,8S,13S,14S)-3-hydroxyimino-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 134990961 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3E,8S,13S,14S)-3-hydroxyimino-13-methyl-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C=CC3=C4CC/C(=N\O)C=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C18H21NO2/c1-18-9-8-14-13-5-3-12(19-21)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-16,21H,2-7H2,1H3/b19-12+/t15-,16+,18+/m1/s1 |
| InChIKey | RBCMSUATFVGVIW-ZFRQOODKSA-N |
| XLogP | 3.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|