C22H40O3 — CID 134990976
1,3,3-trimethyl-2-[(E)-4,6,6-triethoxy-3-methylhex-2-enyl]cyclohexene (PubChem CID 134990976) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(E)-4,6,6-triethoxy-3-methylhex-2-enyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(E)-4,6,6-triethoxy-3-methylhex-2-enyl]cyclohexene |
|---|---|
| PubChem CID | 134990976 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 1,3,3-trimethyl-2-[(E)-4,6,6-triethoxy-3-methylhex-2-enyl]cyclohexene |
| SMILES | CCOC(CC(OCC)/C(C)=C/CC1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C22H40O3/c1-8-23-20(16-21(24-9-2)25-10-3)18(5)13-14-19-17(4)12-11-15-22(19,6)7/h13,20-21H,8-12,14-16H2,1-7H3/b18-13+ |
| InChIKey | PFNDMHGUTSRKFH-QGOAFFKASA-N |
| XLogP | 6.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|