C20H34O2 — CID 134991026
2-[(2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienyl]-1,3,3-trimethylcyclohexene (PubChem CID 134991026) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-[(2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134991026 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 2-[(2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(/C=C/C(C)=C/CC1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C20H34O2/c1-7-21-19(22-8-2)14-12-16(3)11-13-18-17(4)10-9-15-20(18,5)6/h11-12,14,19H,7-10,13,15H2,1-6H3/b14-12+,16-11+ |
| InChIKey | PCNWHDAUFGIYAC-LOAPMXLUSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|