C24H17F3O4SSe — CID 134991037
(13-hydroxy-13λ4-selenahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl) 2,2,2-trifluoroethanesulfonate (PubChem CID 134991037) has the molecular formula C24H17F3O4SSe and a molecular weight of 537.42 g/mol. Its IUPAC name is (13-hydroxy-13λ4-selenahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl) 2,2,2-trifluoroethanesulfonate.
| Compound Name | (13-hydroxy-13λ4-selenahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl) 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 134991037 |
| Molecular Formula | C24H17F3O4SSe |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | (13-hydroxy-13λ4-selenahexacyclo[13.8.0.02,11.03,8.04,22.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl) 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)O[Se]1(O)Cc2ccc3cccc4c5cccc6ccc(c(c2c34)c65)C1 |
| InChI | InChI=1S/C24H17F3O4SSe/c25-24(26,27)13-32(28,29)31-33(30)11-16-9-7-14-3-1-5-18-19-6-2-4-15-8-10-17(12-33)23(21(15)19)22(16)20(14)18/h1-10,30H,11-13H2 |
| InChIKey | GPCYVKXVBCWUGQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|