C32H46N2NiO2 — CID 134991051
N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;1,4-dimethoxybut-2-yne;nickel (PubChem CID 134991051) has the molecular formula C32H46N2NiO2 and a molecular weight of 549.43 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;1,4-dimethoxybut-2-yne;nickel.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;1,4-dimethoxybut-2-yne;nickel |
|---|---|
| PubChem CID | 134991051 |
| Molecular Formula | C32H46N2NiO2 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine;1,4-dimethoxybut-2-yne;nickel |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/C=N/c1c(C(C)C)cccc1C(C)C.COCC#CCOC.[Ni] |
| InChI | InChI=1S/C26H36N2.C6H10O2.Ni/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8;1-7-5-3-4-6-8-2;/h9-20H,1-8H3;5-6H2,1-2H3;/b27-15+,28-16+;; |
| InChIKey | BZBSNHNFXSEMPA-HQRQQUDRSA-N |
| XLogP | 8.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|