About bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel
bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel (PubChem CID 134991135) has the molecular formula C20H24N4NiO2
and a molecular weight of 411.13 g/mol. Its IUPAC name is bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel.
Molecular Properties
| Compound Name | bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel |
| PubChem CID | 134991135 |
| Molecular Formula | C20H24N4NiO2 |
| Molecular Weight | 411.13 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel |
| SMILES | CC1(C)COC(c2ccccn2)=N1.CC1(C)COC(c2ccccn2)=N1.[Ni] |
| InChI | InChI=1S/2C10H12N2O.Ni/c2*1-10(2)7-13-9(12-10)8-5-3-4-6-11-8;/h2*3-6H,7H2,1-2H3; |
| InChIKey | LCFAVOAXKGRWQB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel?
The IUPAC name of bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel (CID 134991135) is bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel.
What is the SMILES notation for bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel?
The canonical SMILES for bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel is CC1(C)COC(c2ccccn2)=N1.CC1(C)COC(c2ccccn2)=N1.[Ni].
What is the InChIKey of bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel?
The InChIKey is LCFAVOAXKGRWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H12N2O.Ni/c2*1-10(2)7-13-9(12-10)8-5-3-4-6-11-8;/h2*3-6H,7H2,1-2H3;.
What are the key properties of bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel?
bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel has a molecular weight of 411.13 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,4-dimethyl-2-pyridin-2-yl-5H-1,3-oxazole);nickel is sourced from PubChem (CID 134991135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).