C6H16FeN2+3 — CID 134991486
iron(3+);N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 134991486) has the molecular formula C6H16FeN2+3 and a molecular weight of 172.05 g/mol. Its IUPAC name is iron(3+);N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | iron(3+);N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 134991486 |
| Molecular Formula | C6H16FeN2+3 |
| Molecular Weight | 172.05 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | iron(3+);N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C.[Fe+3] |
| InChI | InChI=1S/C6H16N2.Fe/c1-7(2)5-6-8(3)4;/h5-6H2,1-4H3;/q;+3 |
| InChIKey | JKQMJCISROWUOA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.05 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|