C5H9F3N2O2S — CID 134991525
1,1,1-trifluoro-N-[(2R)-pyrrolidin-2-yl]methanesulfonamide (PubChem CID 134991525) has the molecular formula C5H9F3N2O2S and a molecular weight of 218.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(2R)-pyrrolidin-2-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(2R)-pyrrolidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 134991525 |
| Molecular Formula | C5H9F3N2O2S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1,1,1-trifluoro-N-[(2R)-pyrrolidin-2-yl]methanesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C5H9F3N2O2S/c6-5(7,8)13(11,12)10-4-2-1-3-9-4/h4,9-10H,1-3H2/t4-/m1/s1 |
| InChIKey | KYKITECDMCOLJI-SCSAIBSYSA-N |
| XLogP | 0.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |