About 1-oxidopyridine-2-thione;triethylazanium
1-oxidopyridine-2-thione;triethylazanium (PubChem CID 134991630) has the molecular formula C11H20N2OS
and a molecular weight of 228.36 g/mol. Its IUPAC name is 1-oxidopyridine-2-thione;triethylazanium.
Molecular Properties
| Compound Name | 1-oxidopyridine-2-thione;triethylazanium |
| PubChem CID | 134991630 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-oxidopyridine-2-thione;triethylazanium |
| SMILES | CC[NH+](CC)CC.[O-]n1ccccc1=S |
| InChI | InChI=1S/C6H15N.C5H4NOS/c1-4-7(5-2)6-3;7-6-4-2-1-3-5(6)8/h4-6H2,1-3H3;1-4H/q;-1/p+1 |
| InChIKey | LVQJJPZFQOHNIA-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 32.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidopyridine-2-thione;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopyridine-2-thione;triethylazanium?
The IUPAC name of 1-oxidopyridine-2-thione;triethylazanium (CID 134991630) is 1-oxidopyridine-2-thione;triethylazanium.
What is the SMILES notation for 1-oxidopyridine-2-thione;triethylazanium?
The canonical SMILES for 1-oxidopyridine-2-thione;triethylazanium is CC[NH+](CC)CC.[O-]n1ccccc1=S.
What is the InChIKey of 1-oxidopyridine-2-thione;triethylazanium?
The InChIKey is LVQJJPZFQOHNIA-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N.C5H4NOS/c1-4-7(5-2)6-3;7-6-4-2-1-3-5(6)8/h4-6H2,1-3H3;1-4H/q;-1/p+1.
What are the key properties of 1-oxidopyridine-2-thione;triethylazanium?
1-oxidopyridine-2-thione;triethylazanium has a molecular weight of 228.36 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopyridine-2-thione;triethylazanium is sourced from PubChem (CID 134991630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).