C11H18O4 — CID 134991919
ethyl (1R,2R,5R,6S)-6-hydroxy-5-(hydroxymethyl)-2-methylcyclohex-3-ene-1-carboxylate (PubChem CID 134991919) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (1R,2R,5R,6S)-6-hydroxy-5-(hydroxymethyl)-2-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,2R,5R,6S)-6-hydroxy-5-(hydroxymethyl)-2-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134991919 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (1R,2R,5R,6S)-6-hydroxy-5-(hydroxymethyl)-2-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](O)[C@@H](CO)C=C[C@H]1C |
| InChI | InChI=1S/C11H18O4/c1-3-15-11(14)9-7(2)4-5-8(6-12)10(9)13/h4-5,7-10,12-13H,3,6H2,1-2H3/t7-,8-,9-,10+/m1/s1 |
| InChIKey | HKUCFYHBZIWUGM-KYXWUPHJSA-N |
| XLogP | 0.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|