C15H17NO — CID 134991931
4-methoxy-1,3-bis(prop-2-enyl)indole (PubChem CID 134991931) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-methoxy-1,3-bis(prop-2-enyl)indole.
| Compound Name | 4-methoxy-1,3-bis(prop-2-enyl)indole |
|---|---|
| PubChem CID | 134991931 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-methoxy-1,3-bis(prop-2-enyl)indole |
| SMILES | C=CCc1cn(CC=C)c2cccc(OC)c12 |
| InChI | InChI=1S/C15H17NO/c1-4-7-12-11-16(10-5-2)13-8-6-9-14(17-3)15(12)13/h4-6,8-9,11H,1-2,7,10H2,3H3 |
| InChIKey | YLQIEDPQWFCQKN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|