C31H26N2O2S2 — CID 134991954
(4S,5S)-5-phenyl-2-[[(4S,5S)-5-phenyl-4-phenylsulfanyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-phenylsulfanyl-4,5-dihydro-1,3-oxazole (PubChem CID 134991954) has the molecular formula C31H26N2O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is (4S,5S)-5-phenyl-2-[[(4S,5S)-5-phenyl-4-phenylsulfanyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-phenylsulfanyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-5-phenyl-2-[[(4S,5S)-5-phenyl-4-phenylsulfanyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 134991954 |
| Molecular Formula | C31H26N2O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (4S,5S)-5-phenyl-2-[[(4S,5S)-5-phenyl-4-phenylsulfanyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(S[C@@H]2N=C(CC3=N[C@@H](Sc4ccccc4)[C@H](c4ccccc4)O3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O2S2/c1-5-13-22(14-6-1)28-30(36-24-17-9-3-10-18-24)32-26(34-28)21-27-33-31(37-25-19-11-4-12-20-25)29(35-27)23-15-7-2-8-16-23/h1-20,28-31H,21H2/t28-,29-,30-,31-/m0/s1 |
| InChIKey | KGVZXHCJPILSTO-ORYMTKCHSA-N |
| XLogP | 7.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |