C25H33O2P2Pt- — CID 134991964
(2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;(2-hydroxyphenyl)methanone;platinum (PubChem CID 134991964) has the molecular formula C25H33O2P2Pt- and a molecular weight of 622.56 g/mol. Its IUPAC name is (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;(2-hydroxyphenyl)methanone;platinum.
| Compound Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;(2-hydroxyphenyl)methanone;platinum |
|---|---|
| PubChem CID | 134991964 |
| Molecular Formula | C25H33O2P2Pt- |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane;(2-hydroxyphenyl)methanone;platinum |
| SMILES | C[C@@H]1CC[C@@H](C)P1c1ccccc1P1[C@H](C)CC[C@H]1C.O=[C-]c1ccccc1O.[Pt] |
| InChI | InChI=1S/C18H28P2.C7H5O2.Pt/c1-13-9-10-14(2)19(13)17-7-5-6-8-18(17)20-15(3)11-12-16(20)4;8-5-6-3-1-2-4-7(6)9;/h5-8,13-16H,9-12H2,1-4H3;1-4,9H;/q;-1;/t13-,14-,15-,16-;;/m1../s1 |
| InChIKey | OSTBKRCCEKETEJ-HHFFVDSRSA-N |
| XLogP | 5.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|