C14H24O2 — CID 134992139
2-methyl-2-(1,2,3,4-tetramethylcyclohex-3-en-1-yl)-1,3-dioxolane (PubChem CID 134992139) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-methyl-2-(1,2,3,4-tetramethylcyclohex-3-en-1-yl)-1,3-dioxolane.
| Compound Name | 2-methyl-2-(1,2,3,4-tetramethylcyclohex-3-en-1-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 134992139 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-methyl-2-(1,2,3,4-tetramethylcyclohex-3-en-1-yl)-1,3-dioxolane |
| SMILES | CC1=C(C)C(C)C(C)(C2(C)OCCO2)CC1 |
| InChI | InChI=1S/C14H24O2/c1-10-6-7-13(4,12(3)11(10)2)14(5)15-8-9-16-14/h12H,6-9H2,1-5H3 |
| InChIKey | DPFMBOTVCQVJGC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|