About 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane
2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane (PubChem CID 134992232) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane |
| PubChem CID | 134992232 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane |
| SMILES | CC1=CCC(C)(C2(C)OCCO2)CC1 |
| InChI | InChI=1S/C12H20O2/c1-10-4-6-11(2,7-5-10)12(3)13-8-9-14-12/h4H,5-9H2,1-3H3 |
| InChIKey | LONAFVWCVDQDDJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane?
The IUPAC name of 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane (CID 134992232) is 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane.
What is the SMILES notation for 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane?
The canonical SMILES for 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane is CC1=CCC(C)(C2(C)OCCO2)CC1.
What is the InChIKey of 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane?
The InChIKey is LONAFVWCVDQDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-10-4-6-11(2,7-5-10)12(3)13-8-9-14-12/h4H,5-9H2,1-3H3.
What are the key properties of 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane?
2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane has a molecular weight of 196.29 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dimethylcyclohex-3-en-1-yl)-2-methyl-1,3-dioxolane is sourced from PubChem (CID 134992232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).