C9H10F2O2 — CID 134992308
(1S,2S,3S,4R)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 134992308) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 134992308 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (1S,2S,3S,4R)-3-(difluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C9H10F2O2/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-8H,3H2,(H,12,13)/t4-,5+,6-,7-/m0/s1 |
| InChIKey | RUMKAJUJSPYCNC-VZFHVOOUSA-N |
| XLogP | 1.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|