About CID 134992472
CID 134992472 (PubChem CID 134992472) has the molecular formula C38H50Cl2Zr
and a molecular weight of 668.95 g/mol.
Molecular Properties
| Compound Name | CID 134992472 |
| PubChem CID | 134992472 |
| Molecular Formula | C38H50Cl2Zr |
| Molecular Weight | 668.95 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1[C]1[CH][CH][C]2C=CC=C[C]21.CC(C)[C@H]1CC[C@@H](C)C[C@@H]1[C]1[CH][CH][C]2C=CC=C[C]21.Cl[Zr]Cl |
| InChI | InChI=1S/2C19H25.2ClH.Zr/c2*1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18;;;/h2*4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3;2*1H;/q;;;;+2/p-2/t2*14-,16-,19+;;;/m11.../s1 |
| InChIKey | PJPPWEIHGLZWBM-TVVONIHRSA-L |
| XLogP | 11.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.95 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134992472 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134992472?
The IUPAC name of CID 134992472 (CID 134992472) is not available.
What is the SMILES notation for CID 134992472?
The canonical SMILES for CID 134992472 is CC(C)[C@H]1CC[C@@H](C)C[C@@H]1[C]1[CH][CH][C]2C=CC=C[C]21.CC(C)[C@H]1CC[C@@H](C)C[C@@H]1[C]1[CH][CH][C]2C=CC=C[C]21.Cl[Zr]Cl.
What is the InChIKey of CID 134992472?
The InChIKey is PJPPWEIHGLZWBM-TVVONIHRSA-L. The full InChI is InChI=1S/2C19H25.2ClH.Zr/c2*1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18;;;/h2*4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3;2*1H;/q;;;;+2/p-2/t2*14-,16-,19+;;;/m11.../s1.
What are the key properties of CID 134992472?
CID 134992472 has a molecular weight of 668.95 g/mol, XLogP of 11.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134992472 is sourced from PubChem (CID 134992472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).