C11H17NO — CID 134992522
(10Z)-1,2,3,6,7,8,9,11a-octahydropyrido[1,2-a]azocin-4-one (PubChem CID 134992522) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (10Z)-1,2,3,6,7,8,9,11a-octahydropyrido[1,2-a]azocin-4-one.
| Compound Name | (10Z)-1,2,3,6,7,8,9,11a-octahydropyrido[1,2-a]azocin-4-one |
|---|---|
| PubChem CID | 134992522 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (10Z)-1,2,3,6,7,8,9,11a-octahydropyrido[1,2-a]azocin-4-one |
| SMILES | O=C1CCCC2/C=C\CCCCN12 |
| InChI | InChI=1S/C11H17NO/c13-11-8-5-7-10-6-3-1-2-4-9-12(10)11/h3,6,10H,1-2,4-5,7-9H2/b6-3- |
| InChIKey | CCLYYNWGNLUTLX-UTCJRWHESA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|