About (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol
(1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol (PubChem CID 134992771) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol.
Molecular Properties
| Compound Name | (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol |
| PubChem CID | 134992771 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol |
| SMILES | C=C[C@H]1OC[C@@H]1[C@H](O)CCCCC |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-7-10(12)9-8-13-11(9)4-2/h4,9-12H,2-3,5-8H2,1H3/t9-,10-,11-/m1/s1 |
| InChIKey | BHLIBTWIPJLWEP-GMTAPVOTSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol?
The IUPAC name of (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol (CID 134992771) is (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol.
What is the SMILES notation for (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol?
The canonical SMILES for (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol is C=C[C@H]1OC[C@@H]1[C@H](O)CCCCC.
What is the InChIKey of (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol?
The InChIKey is BHLIBTWIPJLWEP-GMTAPVOTSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-5-6-7-10(12)9-8-13-11(9)4-2/h4,9-12H,2-3,5-8H2,1H3/t9-,10-,11-/m1/s1.
What are the key properties of (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol?
(1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol has a molecular weight of 184.28 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(2R,3R)-2-ethenyloxetan-3-yl]hexan-1-ol is sourced from PubChem (CID 134992771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).