C10H13IO2 — CID 134992843
(1S,4R,8S)-6-iodo-8-methyl-2-oxatricyclo[5.2.1.04,10]decan-3-one (PubChem CID 134992843) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is (1S,4R,8S)-6-iodo-8-methyl-2-oxatricyclo[5.2.1.04,10]decan-3-one.
| Compound Name | (1S,4R,8S)-6-iodo-8-methyl-2-oxatricyclo[5.2.1.04,10]decan-3-one |
|---|---|
| PubChem CID | 134992843 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | (1S,4R,8S)-6-iodo-8-methyl-2-oxatricyclo[5.2.1.04,10]decan-3-one |
| SMILES | CC1C[C@@H]2OC(=O)C3CC(I)C1C32 |
| InChI | InChI=1S/C10H13IO2/c1-4-2-7-9-5(10(12)13-7)3-6(11)8(4)9/h4-9H,2-3H2,1H3/t4?,5?,6?,7-,8?,9?/m0/s1 |
| InChIKey | SSMGYBJXDCPONE-UNDGYWMYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|