C10H23IOSi2 — CID 134992873
(E,1S,2R)-2-iodo-1,4-bis(trimethylsilyl)but-3-en-1-ol (PubChem CID 134992873) has the molecular formula C10H23IOSi2 and a molecular weight of 342.37 g/mol. Its IUPAC name is (E,1S,2R)-2-iodo-1,4-bis(trimethylsilyl)but-3-en-1-ol.
| Compound Name | (E,1S,2R)-2-iodo-1,4-bis(trimethylsilyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 134992873 |
| Molecular Formula | C10H23IOSi2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (E,1S,2R)-2-iodo-1,4-bis(trimethylsilyl)but-3-en-1-ol |
| SMILES | C[Si](C)(C)/C=C/[C@@H](I)[C@@H](O)[Si](C)(C)C |
| InChI | InChI=1S/C10H23IOSi2/c1-13(2,3)8-7-9(11)10(12)14(4,5)6/h7-10,12H,1-6H3/b8-7+/t9-,10+/m1/s1 |
| InChIKey | CDICXWJPDHSQRK-PSFRMBJNSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|