C8H15BrO2 — CID 134992970
(3S,4S,5S)-4-bromooct-1-ene-3,5-diol (PubChem CID 134992970) has the molecular formula C8H15BrO2 and a molecular weight of 223.11 g/mol. Its IUPAC name is (3S,4S,5S)-4-bromooct-1-ene-3,5-diol.
| Compound Name | (3S,4S,5S)-4-bromooct-1-ene-3,5-diol |
|---|---|
| PubChem CID | 134992970 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (3S,4S,5S)-4-bromooct-1-ene-3,5-diol |
| SMILES | C=C[C@H](O)[C@@H](Br)[C@@H](O)CCC |
| InChI | InChI=1S/C8H15BrO2/c1-3-5-7(11)8(9)6(10)4-2/h4,6-8,10-11H,2-3,5H2,1H3/t6-,7-,8+/m0/s1 |
| InChIKey | FKLSMUGSOQRFQP-BIIVOSGPSA-N |
| XLogP | 1.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|