C10H19BrO2 — CID 134993017
(1S,2R,3S)-2-bromo-1-cyclohexylbutane-1,3-diol (PubChem CID 134993017) has the molecular formula C10H19BrO2 and a molecular weight of 251.16 g/mol. Its IUPAC name is (1S,2R,3S)-2-bromo-1-cyclohexylbutane-1,3-diol.
| Compound Name | (1S,2R,3S)-2-bromo-1-cyclohexylbutane-1,3-diol |
|---|---|
| PubChem CID | 134993017 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (1S,2R,3S)-2-bromo-1-cyclohexylbutane-1,3-diol |
| SMILES | C[C@H](O)[C@@H](Br)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C10H19BrO2/c1-7(12)9(11)10(13)8-5-3-2-4-6-8/h7-10,12-13H,2-6H2,1H3/t7-,9+,10-/m0/s1 |
| InChIKey | JUOJVFQEYBQHOB-SFGNSQDASA-N |
| XLogP | 2.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|