C9H16O6S — CID 134993120
(3aS,4R,6R,6aR)-6-methoxy-2,2-dimethyl-4-methylsulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 134993120) has the molecular formula C9H16O6S and a molecular weight of 252.29 g/mol. Its IUPAC name is (3aS,4R,6R,6aR)-6-methoxy-2,2-dimethyl-4-methylsulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4R,6R,6aR)-6-methoxy-2,2-dimethyl-4-methylsulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 134993120 |
| Molecular Formula | C9H16O6S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (3aS,4R,6R,6aR)-6-methoxy-2,2-dimethyl-4-methylsulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H]1O[C@H](S(C)(=O)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C9H16O6S/c1-9(2)14-5-6(15-9)8(16(4,10)11)13-7(5)12-3/h5-8H,1-4H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | OXBZPKCMEUZXSQ-ULAWRXDQSA-N |
| XLogP | -0.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |