C10H14O2 — CID 134993268
(1R,2R,4R,5S)-3-propan-2-yl-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene (PubChem CID 134993268) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,2R,4R,5S)-3-propan-2-yl-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene.
| Compound Name | (1R,2R,4R,5S)-3-propan-2-yl-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene |
|---|---|
| PubChem CID | 134993268 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,2R,4R,5S)-3-propan-2-yl-6,7-dioxatricyclo[3.2.2.02,4]non-8-ene |
| SMILES | CC(C)C1[C@@H]2[C@@H]1[C@H]1C=C[C@@H]2OO1 |
| InChI | InChI=1S/C10H14O2/c1-5(2)8-9-6-3-4-7(10(8)9)12-11-6/h3-10H,1-2H3/t6-,7+,8?,9-,10-/m1/s1 |
| InChIKey | UFOPWSGDTDMRPL-UAAUVISNSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|