About (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane
(1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane (PubChem CID 134993293) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane |
| PubChem CID | 134993293 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane |
| SMILES | C1CC[C@@]2([C@]34CCCC[C@H]3C4)C[C@H]2C1 |
| InChI | InChI=1S/C14H22/c1-3-7-13(9-11(13)5-1)14-8-4-2-6-12(14)10-14/h11-12H,1-10H2/t11-,12+,13-,14+ |
| InChIKey | RLCDYOAJRKHIFX-KPWCQOOUSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane?
The IUPAC name of (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane (CID 134993293) is (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane.
What is the SMILES notation for (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane?
The canonical SMILES for (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane is C1CC[C@@]2([C@]34CCCC[C@H]3C4)C[C@H]2C1.
What is the InChIKey of (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane?
The InChIKey is RLCDYOAJRKHIFX-KPWCQOOUSA-N. The full InChI is InChI=1S/C14H22/c1-3-7-13(9-11(13)5-1)14-8-4-2-6-12(14)10-14/h11-12H,1-10H2/t11-,12+,13-,14+.
What are the key properties of (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane?
(1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane has a molecular weight of 190.33 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-1-[(1S,6S)-1-bicyclo[4.1.0]heptanyl]bicyclo[4.1.0]heptane is sourced from PubChem (CID 134993293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).