About 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one
3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one (PubChem CID 134993296) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one |
| PubChem CID | 134993296 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCC(CC)CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C12H21NO3/c1-3-5-6-10(4-2)9-11(14)13-7-8-16-12(13)15/h10H,3-9H2,1-2H3 |
| InChIKey | COINICMUTHRMPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one (CID 134993296) is 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one is CCCCC(CC)CC(=O)N1CCOC1=O.
What is the InChIKey of 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one?
The InChIKey is COINICMUTHRMPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-3-5-6-10(4-2)9-11(14)13-7-8-16-12(13)15/h10H,3-9H2,1-2H3.
What are the key properties of 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one?
3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one has a molecular weight of 227.30 g/mol, XLogP of 2.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethylheptanoyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 134993296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).