About [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol
[benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol (PubChem CID 134993326) has the molecular formula C10H16ClO3P
and a molecular weight of 250.66 g/mol. Its IUPAC name is [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol.
Molecular Properties
| Compound Name | [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol |
| PubChem CID | 134993326 |
| Molecular Formula | C10H16ClO3P |
| Molecular Weight | 250.66 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol |
| SMILES | OCP(Cl)(CO)(CO)Cc1ccccc1 |
| InChI | InChI=1S/C10H16ClO3P/c11-15(7-12,8-13,9-14)6-10-4-2-1-3-5-10/h1-5,12-14H,6-9H2 |
| InChIKey | ZMLYBSCOSVLOSI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol?
The IUPAC name of [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol (CID 134993326) is [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol.
What is the SMILES notation for [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol?
The canonical SMILES for [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol is OCP(Cl)(CO)(CO)Cc1ccccc1.
What is the InChIKey of [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol?
The InChIKey is ZMLYBSCOSVLOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClO3P/c11-15(7-12,8-13,9-14)6-10-4-2-1-3-5-10/h1-5,12-14H,6-9H2.
What are the key properties of [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol?
[benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol has a molecular weight of 250.66 g/mol, XLogP of 1.74, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [benzyl-chloro-bis(hydroxymethyl)-λ5-phosphanyl]methanol is sourced from PubChem (CID 134993326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).