About 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one
3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one (PubChem CID 134993350) has the molecular formula C9H9BrO
and a molecular weight of 213.07 g/mol. Its IUPAC name is 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one |
| PubChem CID | 134993350 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cccc(=O)c(C)c1Br |
| InChI | InChI=1S/C9H9BrO/c1-6-4-3-5-8(11)7(2)9(6)10/h3-5H,1-2H3 |
| InChIKey | MNXKUQCELSNONM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one?
The IUPAC name of 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one (CID 134993350) is 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one is Cc1cccc(=O)c(C)c1Br.
What is the InChIKey of 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one?
The InChIKey is MNXKUQCELSNONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO/c1-6-4-3-5-8(11)7(2)9(6)10/h3-5H,1-2H3.
What are the key properties of 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one?
3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one has a molecular weight of 213.07 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dimethylcyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 134993350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).