C13H18O3 — CID 134993388
methyl (1R,6R)-6-methoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate (PubChem CID 134993388) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (1R,6R)-6-methoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate.
| Compound Name | methyl (1R,6R)-6-methoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate |
|---|---|
| PubChem CID | 134993388 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (1R,6R)-6-methoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C=C[C@]1(OC)CCCC2 |
| InChI | InChI=1S/C13H18O3/c1-15-12(14)11-9-10-5-3-4-7-13(11,16-2)8-6-10/h6,8-10H,3-5,7H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | ONKJLFYFRRQLNE-ZWNOBZJWSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|