About (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide
(Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide (PubChem CID 134993453) has the molecular formula C10H18N2O2S
and a molecular weight of 230.33 g/mol. Its IUPAC name is (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide.
Molecular Properties
| Compound Name | (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide |
| PubChem CID | 134993453 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide |
| SMILES | CCNC(=O)/C=C(\SCC)C(=O)NCC |
| InChI | InChI=1S/C10H18N2O2S/c1-4-11-9(13)7-8(15-6-3)10(14)12-5-2/h7H,4-6H2,1-3H3,(H,11,13)(H,12,14)/b8-7- |
| InChIKey | VZXCNSWLIVIAKK-FPLPWBNLSA-N |
| XLogP | 0.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide?
The IUPAC name of (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide (CID 134993453) is (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide.
What is the SMILES notation for (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide?
The canonical SMILES for (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide is CCNC(=O)/C=C(\SCC)C(=O)NCC.
What is the InChIKey of (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide?
The InChIKey is VZXCNSWLIVIAKK-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H18N2O2S/c1-4-11-9(13)7-8(15-6-3)10(14)12-5-2/h7H,4-6H2,1-3H3,(H,11,13)(H,12,14)/b8-7-.
What are the key properties of (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide?
(Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide has a molecular weight of 230.33 g/mol, XLogP of 0.90, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N'-diethyl-2-ethylsulfanylbut-2-enediamide is sourced from PubChem (CID 134993453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).