About [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate
[(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate (PubChem CID 134993617) has the molecular formula C13H22O4Si
and a molecular weight of 270.40 g/mol. Its IUPAC name is [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate.
Molecular Properties
| Compound Name | [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate |
| PubChem CID | 134993617 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate |
| SMILES | C=C(COC(C)=O)/C(=C/COC(C)=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H22O4Si/c1-10(9-17-12(3)15)13(18(4,5)6)7-8-16-11(2)14/h7H,1,8-9H2,2-6H3/b13-7- |
| InChIKey | QUJGDDPYSMPCNF-QPEQYQDCSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate?
The IUPAC name of [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate (CID 134993617) is [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate.
What is the SMILES notation for [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate?
The canonical SMILES for [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate is C=C(COC(C)=O)/C(=C/COC(C)=O)[Si](C)(C)C.
What is the InChIKey of [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate?
The InChIKey is QUJGDDPYSMPCNF-QPEQYQDCSA-N. The full InChI is InChI=1S/C13H22O4Si/c1-10(9-17-12(3)15)13(18(4,5)6)7-8-16-11(2)14/h7H,1,8-9H2,2-6H3/b13-7-.
What are the key properties of [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate?
[(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate has a molecular weight of 270.40 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-4-(acetyloxymethyl)-3-trimethylsilylpenta-2,4-dienyl] acetate is sourced from PubChem (CID 134993617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).