About 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide
4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide (PubChem CID 134993704) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide |
| PubChem CID | 134993704 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCC(=C1C=CC=C1)N(C)C |
| InChI | InChI=1S/C13H20N2O/c1-14(2)12(11-7-5-6-8-11)9-10-13(16)15(3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | TXVQVQCXXMDVQH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide?
The IUPAC name of 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide (CID 134993704) is 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide.
What is the SMILES notation for 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide?
The canonical SMILES for 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide is CN(C)C(=O)CCC(=C1C=CC=C1)N(C)C.
What is the InChIKey of 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide?
The InChIKey is TXVQVQCXXMDVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-14(2)12(11-7-5-6-8-11)9-10-13(16)15(3)4/h5-8H,9-10H2,1-4H3.
What are the key properties of 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide?
4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide has a molecular weight of 220.32 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopenta-2,4-dien-1-ylidene-4-(dimethylamino)-N,N-dimethylbutanamide is sourced from PubChem (CID 134993704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).