C15H21N7S3 — CID 13499374
1-cyano-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 13499374) has the molecular formula C15H21N7S3 and a molecular weight of 395.58 g/mol. Its IUPAC name is 1-cyano-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-cyano-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 13499374 |
| Molecular Formula | C15H21N7S3 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-cyano-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | Cc1[nH]cnc1CSCCN/C(=N/CCSCc1nccs1)NC#N |
| InChI | InChI=1S/C15H21N7S3/c1-12-13(22-11-21-12)8-23-5-2-18-15(20-10-16)19-3-6-24-9-14-17-4-7-25-14/h4,7,11H,2-3,5-6,8-9H2,1H3,(H,21,22)(H2,18,19,20) |
| InChIKey | CKSKVWHYYTZWTK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|