About 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane
2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane (PubChem CID 134993873) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane.
Molecular Properties
| Compound Name | 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane |
| PubChem CID | 134993873 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane |
| SMILES | C(=C/COC1CCCCO1)\CCC1OCCO1 |
| InChI | InChI=1S/C13H22O4/c1(2-6-13-16-10-11-17-13)4-8-14-12-7-3-5-9-15-12/h1,4,12-13H,2-3,5-11H2/b4-1+ |
| InChIKey | LJPKRSFIGFBBEY-DAFODLJHSA-N |
| XLogP | 2.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane?
The IUPAC name of 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane (CID 134993873) is 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane.
What is the SMILES notation for 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane?
The canonical SMILES for 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane is C(=C/COC1CCCCO1)\CCC1OCCO1.
What is the InChIKey of 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane?
The InChIKey is LJPKRSFIGFBBEY-DAFODLJHSA-N. The full InChI is InChI=1S/C13H22O4/c1(2-6-13-16-10-11-17-13)4-8-14-12-7-3-5-9-15-12/h1,4,12-13H,2-3,5-11H2/b4-1+.
What are the key properties of 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane?
2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane has a molecular weight of 242.31 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enoxy]oxane is sourced from PubChem (CID 134993873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).