About 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide
2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 13499390) has the molecular formula C8H15IN4S
and a molecular weight of 326.21 g/mol. Its IUPAC name is 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| PubChem CID | 13499390 |
| Molecular Formula | C8H15IN4S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\N)NCCCc1nccs1.I |
| InChI | InChI=1S/C8H14N4S.HI/c1-10-8(9)12-4-2-3-7-11-5-6-13-7;/h5-6H,2-4H2,1H3,(H3,9,10,12);1H |
| InChIKey | WDMVGQJXEGORCD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide?
The IUPAC name of 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (CID 13499390) is 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
What is the SMILES notation for 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide?
The canonical SMILES for 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide is C/N=C(\N)NCCCc1nccs1.I.
What is the InChIKey of 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide?
The InChIKey is WDMVGQJXEGORCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S.HI/c1-10-8(9)12-4-2-3-7-11-5-6-13-7;/h5-6H,2-4H2,1H3,(H3,9,10,12);1H.
What are the key properties of 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide?
2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide has a molecular weight of 326.21 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[3-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide is sourced from PubChem (CID 13499390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).