About 1-buta-1,2-dienylsulfonyl-3-methylbenzene
1-buta-1,2-dienylsulfonyl-3-methylbenzene (PubChem CID 134993909) has the molecular formula C11H12O2S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-buta-1,2-dienylsulfonyl-3-methylbenzene.
Molecular Properties
| Compound Name | 1-buta-1,2-dienylsulfonyl-3-methylbenzene |
| PubChem CID | 134993909 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1-buta-1,2-dienylsulfonyl-3-methylbenzene |
| SMILES | CC=C=CS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C11H12O2S/c1-3-4-8-14(12,13)11-7-5-6-10(2)9-11/h3,5-9H,1-2H3 |
| InChIKey | SJJRXOWEJXROKL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-buta-1,2-dienylsulfonyl-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,2-dienylsulfonyl-3-methylbenzene?
The IUPAC name of 1-buta-1,2-dienylsulfonyl-3-methylbenzene (CID 134993909) is 1-buta-1,2-dienylsulfonyl-3-methylbenzene.
What is the SMILES notation for 1-buta-1,2-dienylsulfonyl-3-methylbenzene?
The canonical SMILES for 1-buta-1,2-dienylsulfonyl-3-methylbenzene is CC=C=CS(=O)(=O)c1cccc(C)c1.
What is the InChIKey of 1-buta-1,2-dienylsulfonyl-3-methylbenzene?
The InChIKey is SJJRXOWEJXROKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S/c1-3-4-8-14(12,13)11-7-5-6-10(2)9-11/h3,5-9H,1-2H3.
What are the key properties of 1-buta-1,2-dienylsulfonyl-3-methylbenzene?
1-buta-1,2-dienylsulfonyl-3-methylbenzene has a molecular weight of 208.28 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,2-dienylsulfonyl-3-methylbenzene is sourced from PubChem (CID 134993909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).