C12H16O3 — CID 134993964
methyl (1S,3aS,6aR)-1-acetyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate (PubChem CID 134993964) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl (1S,3aS,6aR)-1-acetyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate.
| Compound Name | methyl (1S,3aS,6aR)-1-acetyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 134993964 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl (1S,3aS,6aR)-1-acetyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2CCC[C@H]2[C@@H]1C(C)=O |
| InChI | InChI=1S/C12H16O3/c1-7(13)11-9-5-3-4-8(9)6-10(11)12(14)15-2/h6,8-9,11H,3-5H2,1-2H3/t8-,9-,11+/m1/s1 |
| InChIKey | CJFZBRUWLNAHJG-KKZNHRDASA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |