C14H26N2 — CID 134994082
(2R,3R)-2,3-bis[(E)-pent-1-enyl]piperazine (PubChem CID 134994082) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(E)-pent-1-enyl]piperazine.
| Compound Name | (2R,3R)-2,3-bis[(E)-pent-1-enyl]piperazine |
|---|---|
| PubChem CID | 134994082 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2R,3R)-2,3-bis[(E)-pent-1-enyl]piperazine |
| SMILES | CCC/C=C/[C@H]1NCCN[C@@H]1/C=C/CCC |
| InChI | InChI=1S/C14H26N2/c1-3-5-7-9-13-14(10-8-6-4-2)16-12-11-15-13/h7-10,13-16H,3-6,11-12H2,1-2H3/b9-7+,10-8+/t13-,14-/m1/s1 |
| InChIKey | RZNSBYCNBKNSGZ-JPSXRDQDSA-N |
| XLogP | 2.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|