C8H15NO2S2 — CID 134994152
(1R,2R)-N,N-diethyl-1-oxo-1,3-dithiolane-2-carboxamide (PubChem CID 134994152) has the molecular formula C8H15NO2S2 and a molecular weight of 221.35 g/mol. Its IUPAC name is (1R,2R)-N,N-diethyl-1-oxo-1,3-dithiolane-2-carboxamide.
| Compound Name | (1R,2R)-N,N-diethyl-1-oxo-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 134994152 |
| Molecular Formula | C8H15NO2S2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (1R,2R)-N,N-diethyl-1-oxo-1,3-dithiolane-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1SCC[S@]1=O |
| InChI | InChI=1S/C8H15NO2S2/c1-3-9(4-2)7(10)8-12-5-6-13(8)11/h8H,3-6H2,1-2H3/t8-,13-/m1/s1 |
| InChIKey | HIVJOISYDCLGTP-AMIZOPFISA-N |
| XLogP | 0.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |